C27H30N2O2 — CID 69217555
3-(4-aminophenyl)-1-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one (PubChem CID 69217555) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-(4-aminophenyl)-1-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(4-aminophenyl)-1-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 69217555 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 3-(4-aminophenyl)-1-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(-c2ccc(OCCN(C)C)c(C(=O)C=Cc3ccc(N)cc3)c2)c1 |
| InChI | InChI=1S/C27H30N2O2/c1-19-15-20(2)17-23(16-19)22-8-12-27(31-14-13-29(3)4)25(18-22)26(30)11-7-21-5-9-24(28)10-6-21/h5-12,15-18H,13-14,28H2,1-4H3 |
| InChIKey | YBOOTWVJDBSULK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|