C26H27NO3 — CID 69217633
1-[2-[2-(dimethylamino)ethoxy]-5-phenylphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 69217633) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethoxy]-5-phenylphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[2-[2-(dimethylamino)ethoxy]-5-phenylphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69217633 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethoxy]-5-phenylphenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc(-c3ccccc3)ccc2OCCN(C)C)cc1 |
| InChI | InChI=1S/C26H27NO3/c1-27(2)17-18-30-26-16-12-22(21-7-5-4-6-8-21)19-24(26)25(28)15-11-20-9-13-23(29-3)14-10-20/h4-16,19H,17-18H2,1-3H3 |
| InChIKey | SVTXHYSWQOYDGG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|