C27H28FNO4 — CID 69216080
3-[2-[2-(dimethylamino)ethoxy]-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 69216080) has the molecular formula C27H28FNO4 and a molecular weight of 449.52 g/mol. Its IUPAC name is 3-[2-[2-(dimethylamino)ethoxy]-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2-[2-(dimethylamino)ethoxy]-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69216080 |
| Molecular Formula | C27H28FNO4 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-[2-[2-(dimethylamino)ethoxy]-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cc(-c3ccccc3OC)ccc2OCCN(C)C)c(F)c1 |
| InChI | InChI=1S/C27H28FNO4/c1-29(2)15-16-33-26-14-10-19(22-7-5-6-8-27(22)32-4)17-20(26)9-13-25(30)23-12-11-21(31-3)18-24(23)28/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | OLSNWYIUSJPPHT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|