C29H32FN2O3+ — CID 69226978
3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 69226978) has the molecular formula C29H32FN2O3+ and a molecular weight of 475.58 g/mol. Its IUPAC name is 3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69226978 |
| Molecular Formula | C29H32FN2O3+ |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 3-[2-(4,4-dimethylpiperazin-4-ium-1-yl)-5-(2-methoxyphenyl)phenyl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cc(-c3ccccc3OC)ccc2N2CC[N+](C)(C)CC2)c(F)c1 |
| InChI | InChI=1S/C29H32FN2O3/c1-32(2)17-15-31(16-18-32)27-13-9-21(24-7-5-6-8-29(24)35-4)19-22(27)10-14-28(33)25-12-11-23(34-3)20-26(25)30/h5-14,19-20H,15-18H2,1-4H3/q+1 |
| InChIKey | SUMAAPFMLYDCGH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|