C28H29FN2O3 — CID 68745002
1-(2-fluoro-4-methoxyphenyl)-3-[5-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one (PubChem CID 68745002) has the molecular formula C28H29FN2O3 and a molecular weight of 460.55 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-3-[5-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-3-[5-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68745002 |
| Molecular Formula | C28H29FN2O3 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-3-[5-(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(-c2ccc(N3CCN(C)CC3)c(C=CC(=O)c3ccc(OC)cc3F)c2)cc1 |
| InChI | InChI=1S/C28H29FN2O3/c1-30-14-16-31(17-15-30)27-12-6-21(20-4-8-23(33-2)9-5-20)18-22(27)7-13-28(32)25-11-10-24(34-3)19-26(25)29/h4-13,18-19H,14-17H2,1-3H3 |
| InChIKey | ZYOWRXBACFATHN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|