C22H24BrFN2O2 — CID 68746517
(E)-1-[5-bromo-2-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 68746517) has the molecular formula C22H24BrFN2O2 and a molecular weight of 447.35 g/mol. Its IUPAC name is (E)-1-[5-bromo-2-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-bromo-2-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68746517 |
| Molecular Formula | C22H24BrFN2O2 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (E)-1-[5-bromo-2-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(Br)ccc2N2CCCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C22H24BrFN2O2/c1-25-10-3-11-26(13-12-25)21-8-6-17(23)14-19(21)22(27)9-5-16-4-7-18(28-2)15-20(16)24/h4-9,14-15H,3,10-13H2,1-2H3/b9-5+ |
| InChIKey | ATWBZVCWFQXLSP-WEVVVXLNSA-N |
| XLogP | 4.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|