C27H33ClN2O3 — CID 68746678
(E)-1-[4-chloro-2-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]-3-[4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one (PubChem CID 68746678) has the molecular formula C27H33ClN2O3 and a molecular weight of 469.03 g/mol. Its IUPAC name is (E)-1-[4-chloro-2-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]-3-[4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-chloro-2-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]-3-[4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68746678 |
| Molecular Formula | C27H33ClN2O3 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (E)-1-[4-chloro-2-methoxy-3-(2-methylbut-3-en-2-yl)phenyl]-3-[4-methoxy-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
| SMILES | C=CC(C)(C)c1c(Cl)ccc(C(=O)/C=C/c2ccc(OC)cc2N2CCN(C)CC2)c1OC |
| InChI | InChI=1S/C27H33ClN2O3/c1-7-27(2,3)25-22(28)12-11-21(26(25)33-6)24(31)13-9-19-8-10-20(32-5)18-23(19)30-16-14-29(4)15-17-30/h7-13,18H,1,14-17H2,2-6H3/b13-9+ |
| InChIKey | GATMCAUAFXRIOM-UKTHLTGXSA-N |
| XLogP | 5.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|