C29H31FN2O3 — CID 68746656
(E)-3-(2-fluoro-4-methoxyphenyl)-1-[5-(2-methoxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)phenyl]prop-2-en-1-one (PubChem CID 68746656) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is (E)-3-(2-fluoro-4-methoxyphenyl)-1-[5-(2-methoxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluoro-4-methoxyphenyl)-1-[5-(2-methoxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68746656 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (E)-3-(2-fluoro-4-methoxyphenyl)-1-[5-(2-methoxyphenyl)-2-(4-methyl-1,4-diazepan-1-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(-c3ccccc3OC)ccc2N2CCCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C29H31FN2O3/c1-31-15-6-16-32(18-17-31)27-13-10-22(24-7-4-5-8-29(24)35-3)19-25(27)28(33)14-11-21-9-12-23(34-2)20-26(21)30/h4-5,7-14,19-20H,6,15-18H2,1-3H3/b14-11+ |
| InChIKey | IZFHQWQEPTXLJB-SDNWHVSQSA-N |
| XLogP | 5.55 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|