C27H26F2N2O2 — CID 68744017
3-(2,6-difluorophenyl)-1-[5-(2-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one (PubChem CID 68744017) has the molecular formula C27H26F2N2O2 and a molecular weight of 448.51 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-1-[5-(2-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(2,6-difluorophenyl)-1-[5-(2-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68744017 |
| Molecular Formula | C27H26F2N2O2 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3-(2,6-difluorophenyl)-1-[5-(2-methoxyphenyl)-2-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccccc1-c1ccc(N2CCN(C)CC2)c(C(=O)C=Cc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C27H26F2N2O2/c1-30-14-16-31(17-15-30)25-12-10-19(20-6-3-4-9-27(20)33-2)18-22(25)26(32)13-11-21-23(28)7-5-8-24(21)29/h3-13,18H,14-17H2,1-2H3 |
| InChIKey | JGMYQDJQSIEVHK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|