C31H37NO3 — CID 69216160
1-(2-butoxyphenyl)-3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one (PubChem CID 69216160) has the molecular formula C31H37NO3 and a molecular weight of 471.64 g/mol. Its IUPAC name is 1-(2-butoxyphenyl)-3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-(2-butoxyphenyl)-3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 69216160 |
| Molecular Formula | C31H37NO3 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 1-(2-butoxyphenyl)-3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]prop-2-en-1-one |
| SMILES | CCCCOc1ccccc1C(=O)C=Cc1cc(-c2cc(C)cc(C)c2)ccc1OCCN(C)C |
| InChI | InChI=1S/C31H37NO3/c1-6-7-17-34-31-11-9-8-10-28(31)29(33)14-12-26-22-25(27-20-23(2)19-24(3)21-27)13-15-30(26)35-18-16-32(4)5/h8-15,19-22H,6-7,16-18H2,1-5H3 |
| InChIKey | GKLKSPKCCBFJNY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|