C27H29NO3 — CID 69218021
3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one (PubChem CID 69218021) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69218021 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-[2-[2-(dimethylamino)ethoxy]-5-(3,5-dimethylphenyl)phenyl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(-c2ccc(OCCN(C)C)c(C=CC(=O)c3cccc(O)c3)c2)c1 |
| InChI | InChI=1S/C27H29NO3/c1-19-14-20(2)16-24(15-19)21-9-11-27(31-13-12-28(3)4)23(17-21)8-10-26(30)22-6-5-7-25(29)18-22/h5-11,14-18,29H,12-13H2,1-4H3 |
| InChIKey | JDFZNHDUGRANDJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|