C30H35N3O3 — CID 69218995
2-(dimethylamino)-N-[3-[3-[2-[2-(dimethylamino)ethoxy]-5-(2-methylphenyl)phenyl]prop-2-enoyl]phenyl]acetamide (PubChem CID 69218995) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[3-[2-[2-(dimethylamino)ethoxy]-5-(2-methylphenyl)phenyl]prop-2-enoyl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[3-[3-[2-[2-(dimethylamino)ethoxy]-5-(2-methylphenyl)phenyl]prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 69218995 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[3-[2-[2-(dimethylamino)ethoxy]-5-(2-methylphenyl)phenyl]prop-2-enoyl]phenyl]acetamide |
| SMILES | Cc1ccccc1-c1ccc(OCCN(C)C)c(C=CC(=O)c2cccc(NC(=O)CN(C)C)c2)c1 |
| InChI | InChI=1S/C30H35N3O3/c1-22-9-6-7-12-27(22)23-14-16-29(36-18-17-32(2)3)25(19-23)13-15-28(34)24-10-8-11-26(20-24)31-30(35)21-33(4)5/h6-16,19-20H,17-18,21H2,1-5H3,(H,31,35) |
| InChIKey | JHIMAQBXBHMEAQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|