C19H18Cl2N2O2 — CID 68745214
N-[3-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenyl]-2-(dimethylamino)acetamide (PubChem CID 68745214) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is N-[3-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 68745214 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-[3-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1cccc(C(=O)/C=C/c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-23(2)12-19(25)22-16-5-3-4-14(10-16)18(24)9-7-13-6-8-15(20)11-17(13)21/h3-11H,12H2,1-2H3,(H,22,25)/b9-7+ |
| InChIKey | FYKHLTYOLXPAMZ-VQHVLOKHSA-N |
| XLogP | 4.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|