C19H19Cl2NO3 — CID 86578550
(E)-1-[3-[bis(2-hydroxyethyl)amino]phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 86578550) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is (E)-1-[3-[bis(2-hydroxyethyl)amino]phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[bis(2-hydroxyethyl)amino]phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86578550 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (E)-1-[3-[bis(2-hydroxyethyl)amino]phenyl]-3-(2,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)c1cccc(N(CCO)CCO)c1 |
| InChI | InChI=1S/C19H19Cl2NO3/c20-16-6-4-14(18(21)13-16)5-7-19(25)15-2-1-3-17(12-15)22(8-10-23)9-11-24/h1-7,12-13,23-24H,8-11H2/b7-5+ |
| InChIKey | RDRDOHDZYAHKAM-FNORWQNLSA-N |
| XLogP | 3.68 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|