C21H15Cl2NO — CID 2343564
(E)-3-(2,4-dichlorophenyl)-N,N-diphenylprop-2-enamide (PubChem CID 2343564) has the molecular formula C21H15Cl2NO and a molecular weight of 368.26 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N,N-diphenylprop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N,N-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 2343564 |
| Molecular Formula | C21H15Cl2NO |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N,N-diphenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15Cl2NO/c22-17-13-11-16(20(23)15-17)12-14-21(25)24(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-15H/b14-12+ |
| InChIKey | YWUQWEUOTHMAQD-WYMLVPIESA-N |
| XLogP | 6.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|