C20H22Cl2N2O — CID 68744508
3-(2,4-dichlorophenyl)-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-en-1-one (PubChem CID 68744508) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.32 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-en-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68744508 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[4-[2-(dimethylamino)ethyl-methylamino]phenyl]prop-2-en-1-one |
| SMILES | CN(C)CCN(C)c1ccc(C(=O)C=Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O/c1-23(2)12-13-24(3)18-9-5-16(6-10-18)20(25)11-7-15-4-8-17(21)14-19(15)22/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | NHCULTGLOYGJNM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|