C18H13Cl2O4- — CID 8024119
(2S)-2-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenoxy]propanoate (PubChem CID 8024119) has the molecular formula C18H13Cl2O4- and a molecular weight of 364.20 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenoxy]propanoate.
| Compound Name | (2S)-2-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 8024119 |
| Molecular Formula | C18H13Cl2O4- |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | (2S)-2-[4-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]phenoxy]propanoate |
| SMILES | C[C@H](Oc1ccc(C(=O)/C=C/c2ccc(Cl)cc2Cl)cc1)C(=O)[O-] |
| InChI | InChI=1S/C18H14Cl2O4/c1-11(18(22)23)24-15-7-3-13(4-8-15)17(21)9-5-12-2-6-14(19)10-16(12)20/h2-11H,1H3,(H,22,23)/p-1/b9-5+/t11-/m0/s1 |
| InChIKey | DPWJOTSLCGSWAB-NKLKJHRZSA-M |
| XLogP | 3.41 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|