C18H14Cl2O3 — CID 5194735
3-(2,4-dichlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one (PubChem CID 5194735) has the molecular formula C18H14Cl2O3 and a molecular weight of 349.21 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5194735 |
| Molecular Formula | C18H14Cl2O3 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H14Cl2O3/c19-14-5-2-12(15(20)11-14)3-6-16(21)13-4-7-17-18(10-13)23-9-1-8-22-17/h2-7,10-11H,1,8-9H2 |
| InChIKey | WCGODHROQSBCER-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|