C18H11F5O3 — CID 8831897
(E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one (PubChem CID 8831897) has the molecular formula C18H11F5O3 and a molecular weight of 370.27 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8831897 |
| Molecular Formula | C18H11F5O3 |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2,3,4,5,6-pentafluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H11F5O3/c19-14-10(15(20)17(22)18(23)16(14)21)3-4-11(24)9-2-5-12-13(8-9)26-7-1-6-25-12/h2-5,8H,1,6-7H2/b4-3+ |
| InChIKey | OGCACOYPUDYNPJ-ONEGZZNKSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|