C18H15ClO3 — CID 8831867
(E)-3-(4-chlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one (PubChem CID 8831867) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8831867 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H15ClO3/c19-15-6-2-13(3-7-15)4-8-16(20)14-5-9-17-18(12-14)22-11-1-10-21-17/h2-9,12H,1,10-11H2/b8-4+ |
| InChIKey | MIIDAJDQFPRFTH-XBXARRHUSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|