C19H16F2O4 — CID 8831884
(E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one (PubChem CID 8831884) has the molecular formula C19H16F2O4 and a molecular weight of 346.33 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8831884 |
| Molecular Formula | C19H16F2O4 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H16F2O4/c20-19(21)25-15-6-2-13(3-7-15)4-8-16(22)14-5-9-17-18(12-14)24-11-1-10-23-17/h2-9,12,19H,1,10-11H2/b8-4+ |
| InChIKey | CAJGOLNSHTZRKQ-XBXARRHUSA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|