C18H14F2N2O5 — CID 26798718
N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 26798718) has the molecular formula C18H14F2N2O5 and a molecular weight of 376.32 g/mol. Its IUPAC name is N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 26798718 |
| Molecular Formula | C18H14F2N2O5 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14F2N2O5/c19-18(20)27-13-5-1-11(2-6-13)3-8-16(23)21-22-17(24)12-4-7-14-15(9-12)26-10-25-14/h1-9,18H,10H2,(H,21,23)(H,22,24)/b8-3+ |
| InChIKey | GVSBKXJRQAICJN-FPYGCLRLSA-N |
| XLogP | 2.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|