C17H13F3N2O3 — CID 7946032
N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-4-fluorobenzohydrazide (PubChem CID 7946032) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 7946032 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N'-[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]-4-fluorobenzohydrazide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F3N2O3/c18-13-6-4-12(5-7-13)16(24)22-21-15(23)10-3-11-1-8-14(9-2-11)25-17(19)20/h1-10,17H,(H,21,23)(H,22,24)/b10-3+ |
| InChIKey | UMSRGUNVPMVTJV-XCVCLJGOSA-N |
| XLogP | 2.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|