C25H22F2N2O3 — CID 132972832
4-[(Z)-3-[[[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 132972832) has the molecular formula C25H22F2N2O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-[(Z)-3-[[[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(Z)-3-[[[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 132972832 |
| Molecular Formula | C25H22F2N2O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-[(Z)-3-[[[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C\C(=O)NC(c2ccccc2)c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H22F2N2O3/c1-28-24(31)20-10-7-17(8-11-20)9-16-22(30)29-23(18-5-3-2-4-6-18)19-12-14-21(15-13-19)32-25(26)27/h2-16,23,25H,1H3,(H,28,31)(H,29,30)/b16-9- |
| InChIKey | ZSFTVJAXDWGZDA-SXGWCWSVSA-N |
| XLogP | 4.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|