C20H21F2NO2 — CID 7958328
(E)-3-[4-(difluoromethoxy)phenyl]-N-[(2R)-4-phenylbutan-2-yl]prop-2-enamide (PubChem CID 7958328) has the molecular formula C20H21F2NO2 and a molecular weight of 345.39 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-[(2R)-4-phenylbutan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[(2R)-4-phenylbutan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7958328 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[(2R)-4-phenylbutan-2-yl]prop-2-enamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H21F2NO2/c1-15(7-8-16-5-3-2-4-6-16)23-19(24)14-11-17-9-12-18(13-10-17)25-20(21)22/h2-6,9-15,20H,7-8H2,1H3,(H,23,24)/b14-11+/t15-/m1/s1 |
| InChIKey | VEXASCGMBSLGQO-ATGUSINASA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|