C20H24N2O3S — CID 51333617
(E)-3-[4-(methanesulfonamido)phenyl]-N-(4-phenylbutan-2-yl)prop-2-enamide (PubChem CID 51333617) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (E)-3-[4-(methanesulfonamido)phenyl]-N-(4-phenylbutan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(methanesulfonamido)phenyl]-N-(4-phenylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51333617 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-3-[4-(methanesulfonamido)phenyl]-N-(4-phenylbutan-2-yl)prop-2-enamide |
| SMILES | CC(CCc1ccccc1)NC(=O)/C=C/c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-16(8-9-17-6-4-3-5-7-17)21-20(23)15-12-18-10-13-19(14-11-18)22-26(2,24)25/h3-7,10-16,22H,8-9H2,1-2H3,(H,21,23)/b15-12+ |
| InChIKey | LPSDEMRQYVXOLS-NTCAYCPXSA-N |
| XLogP | 3.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|