C14H17F2NO3 — CID 73422099
3-[4-(difluoromethoxy)phenyl]-N-(1-methoxypropan-2-yl)prop-2-enamide (PubChem CID 73422099) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(1-methoxypropan-2-yl)prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(1-methoxypropan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 73422099 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(1-methoxypropan-2-yl)prop-2-enamide |
| SMILES | COCC(C)NC(=O)C=Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H17F2NO3/c1-10(9-19-2)17-13(18)8-5-11-3-6-12(7-4-11)20-14(15)16/h3-8,10,14H,9H2,1-2H3,(H,17,18) |
| InChIKey | YTXSNXAZWZBHMB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|