C23H25F2NO5 — CID 24516732
propan-2-yl 3-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 24516732) has the molecular formula C23H25F2NO5 and a molecular weight of 433.45 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 24516732 |
| Molecular Formula | C23H25F2NO5 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(C(CC(=O)OC(C)C)NC(=O)/C=C/c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H25F2NO5/c1-15(2)30-22(28)14-20(17-7-11-18(29-3)12-8-17)26-21(27)13-6-16-4-9-19(10-5-16)31-23(24)25/h4-13,15,20,23H,14H2,1-3H3,(H,26,27)/b13-6+ |
| InChIKey | GHTLFYZIVGCZMJ-AWNIVKPZSA-N |
| XLogP | 4.51 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|