C21H22BrNO4 — CID 42920394
methyl 3-(4-bromophenyl)-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 42920394) has the molecular formula C21H22BrNO4 and a molecular weight of 432.31 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 42920394 |
| Molecular Formula | C21H22BrNO4 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | methyl 3-(4-bromophenyl)-3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(CC(=O)OC)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H22BrNO4/c1-3-27-18-11-4-15(5-12-18)6-13-20(24)23-19(14-21(25)26-2)16-7-9-17(22)10-8-16/h4-13,19H,3,14H2,1-2H3,(H,23,24)/b13-6+ |
| InChIKey | RTSDZPNQDPIOCF-AWNIVKPZSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|