C24H28N2O5 — CID 55440355
methyl 3-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoylamino]-3-(4-methylphenyl)propanoate (PubChem CID 55440355) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl 3-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoylamino]-3-(4-methylphenyl)propanoate.
| Compound Name | methyl 3-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoylamino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 55440355 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl 3-[2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoylamino]-3-(4-methylphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)C(C)NC(=O)C=Cc1ccc(OC)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-16-5-10-19(11-6-16)21(15-23(28)31-4)26-24(29)17(2)25-22(27)14-9-18-7-12-20(30-3)13-8-18/h5-14,17,21H,15H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | RVGWJQJOXDUYJF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|