C24H28N2O5 — CID 55908765
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanamide (PubChem CID 55908765) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 55908765 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanamide |
| SMILES | CCC(NC(=O)C(C)NC(=O)C=Cc1ccc(OC)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H28N2O5/c1-4-20(18-8-11-21-22(15-18)31-14-13-30-21)26-24(28)16(2)25-23(27)12-7-17-5-9-19(29-3)10-6-17/h5-12,15-16,20H,4,13-14H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | ZRSFCEMWAYCCQG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|