C27H25NO5 — CID 59752693
methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 59752693) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 59752693 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | methyl 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)/C=C/c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H25NO5/c1-31-27(30)18-23(22-12-13-24-25(17-22)33-16-15-32-24)28-26(29)14-9-19-7-10-21(11-8-19)20-5-3-2-4-6-20/h2-14,17,23H,15-16,18H2,1H3,(H,28,29)/b14-9+ |
| InChIKey | MZTPGLFQYFEWAQ-NTEUORMPSA-N |
| XLogP | 4.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|