C21H23NO3 — CID 71843424
N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]-3-phenylprop-2-enamide (PubChem CID 71843424) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]-3-phenylprop-2-enamide.
| Compound Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71843424 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propyl]-3-phenylprop-2-enamide |
| SMILES | CCC(NC(=O)C=Cc1ccccc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H23NO3/c1-2-18(22-21(23)12-9-16-7-4-3-5-8-16)17-10-11-19-20(15-17)25-14-6-13-24-19/h3-5,7-12,15,18H,2,6,13-14H2,1H3,(H,22,23) |
| InChIKey | JKPVZXSBFYXWMI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|