C25H25NO3 — CID 60538414
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2,2-diphenylacetamide (PubChem CID 60538414) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2,2-diphenylacetamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 60538414 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-2,2-diphenylacetamide |
| SMILES | CCC(NC(=O)C(c1ccccc1)c1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H25NO3/c1-2-21(20-13-14-22-23(17-20)29-16-15-28-22)26-25(27)24(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,17,21,24H,2,15-16H2,1H3,(H,26,27) |
| InChIKey | FWMPPVLKCVLLEH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |