C23H24N2O7 — CID 55440276
propan-2-yl 3-[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55440276) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55440276 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)/C=C/c1ccc2c(c1)OCCO2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N2O7/c1-15(2)32-23(27)14-18(17-5-3-4-6-19(17)25(28)29)24-22(26)10-8-16-7-9-20-21(13-16)31-12-11-30-20/h3-10,13,15,18H,11-12,14H2,1-2H3,(H,24,26)/b10-8+ |
| InChIKey | QUWBLJVRUCUNHU-CSKARUKUSA-N |
| XLogP | 3.58 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|