C21H21ClN2O7 — CID 30091746
propan-2-yl (3S)-3-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]-3-(2-nitrophenyl)propanoate (PubChem CID 30091746) has the molecular formula C21H21ClN2O7 and a molecular weight of 448.86 g/mol. Its IUPAC name is propan-2-yl (3S)-3-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl (3S)-3-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 30091746 |
| Molecular Formula | C21H21ClN2O7 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | propan-2-yl (3S)-3-[(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)C[C@H](NC(=O)c1cc(Cl)c2c(c1)OCCO2)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21ClN2O7/c1-12(2)31-19(25)11-16(14-5-3-4-6-17(14)24(27)28)23-21(26)13-9-15(22)20-18(10-13)29-7-8-30-20/h3-6,9-10,12,16H,7-8,11H2,1-2H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | SPSFNVSQZUAFNG-INIZCTEOSA-N |
| XLogP | 3.83 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|