C18H18ClN3O5 — CID 46697878
propan-2-yl 3-[(6-chloropyridine-3-carbonyl)amino]-3-(2-nitrophenyl)propanoate (PubChem CID 46697878) has the molecular formula C18H18ClN3O5 and a molecular weight of 391.81 g/mol. Its IUPAC name is propan-2-yl 3-[(6-chloropyridine-3-carbonyl)amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(6-chloropyridine-3-carbonyl)amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46697878 |
| Molecular Formula | C18H18ClN3O5 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | propan-2-yl 3-[(6-chloropyridine-3-carbonyl)amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1ccc(Cl)nc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18ClN3O5/c1-11(2)27-17(23)9-14(13-5-3-4-6-15(13)22(25)26)21-18(24)12-7-8-16(19)20-10-12/h3-8,10-11,14H,9H2,1-2H3,(H,21,24) |
| InChIKey | TXSUXZAMQQKWRJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|