C19H19N3O5 — CID 9278702
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-nitroanilino)ethyl]prop-2-enamide (PubChem CID 9278702) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-nitroanilino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-nitroanilino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9278702 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-nitroanilino)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCCO2)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O5/c23-19(8-6-14-5-7-17-18(13-14)27-12-11-26-17)21-10-9-20-15-3-1-2-4-16(15)22(24)25/h1-8,13,20H,9-12H2,(H,21,23)/b8-6+ |
| InChIKey | NPTNCDSVJMLUQK-SOFGYWHQSA-N |
| XLogP | 2.61 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|