C24H24N4O5 — CID 55440192
propan-2-yl 3-(2-nitrophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate (PubChem CID 55440192) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is propan-2-yl 3-(2-nitrophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-(2-nitrophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 55440192 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | propan-2-yl 3-(2-nitrophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)/C=C/c1cnn(-c2ccccc2)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N4O5/c1-17(2)33-24(30)14-21(20-10-6-7-11-22(20)28(31)32)26-23(29)13-12-18-15-25-27(16-18)19-8-4-3-5-9-19/h3-13,15-17,21H,14H2,1-2H3,(H,26,29)/b13-12+ |
| InChIKey | MKJMYCOUKNSHHS-OUKQBFOZSA-N |
| XLogP | 3.99 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|