C24H26ClN3O3 — CID 18287238
propan-2-yl 3-(2-chlorophenyl)-3-[3-(1-phenylpyrazol-4-yl)propanoylamino]propanoate (PubChem CID 18287238) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is propan-2-yl 3-(2-chlorophenyl)-3-[3-(1-phenylpyrazol-4-yl)propanoylamino]propanoate.
| Compound Name | propan-2-yl 3-(2-chlorophenyl)-3-[3-(1-phenylpyrazol-4-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 18287238 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | propan-2-yl 3-(2-chlorophenyl)-3-[3-(1-phenylpyrazol-4-yl)propanoylamino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CCc1cnn(-c2ccccc2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C24H26ClN3O3/c1-17(2)31-24(30)14-22(20-10-6-7-11-21(20)25)27-23(29)13-12-18-15-26-28(16-18)19-8-4-3-5-9-19/h3-11,15-17,22H,12-14H2,1-2H3,(H,27,29) |
| InChIKey | AYHQDIXMAHUWHN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |