C19H22ClNO4 — CID 24603772
propan-2-yl 3-(2-chlorophenyl)-3-[3-(furan-2-yl)propanoylamino]propanoate (PubChem CID 24603772) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is propan-2-yl 3-(2-chlorophenyl)-3-[3-(furan-2-yl)propanoylamino]propanoate.
| Compound Name | propan-2-yl 3-(2-chlorophenyl)-3-[3-(furan-2-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 24603772 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | propan-2-yl 3-(2-chlorophenyl)-3-[3-(furan-2-yl)propanoylamino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CCc1ccco1)c1ccccc1Cl |
| InChI | InChI=1S/C19H22ClNO4/c1-13(2)25-19(23)12-17(15-7-3-4-8-16(15)20)21-18(22)10-9-14-6-5-11-24-14/h3-8,11,13,17H,9-10,12H2,1-2H3,(H,21,22) |
| InChIKey | NKCMOJXZUKGUJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |