C23H27ClN2O4 — CID 24516279
propan-2-yl 3-[(3-acetamido-3-phenylpropanoyl)amino]-3-(2-chlorophenyl)propanoate (PubChem CID 24516279) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is propan-2-yl 3-[(3-acetamido-3-phenylpropanoyl)amino]-3-(2-chlorophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(3-acetamido-3-phenylpropanoyl)amino]-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 24516279 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | propan-2-yl 3-[(3-acetamido-3-phenylpropanoyl)amino]-3-(2-chlorophenyl)propanoate |
| SMILES | CC(=O)NC(CC(=O)NC(CC(=O)OC(C)C)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-15(2)30-23(29)14-21(18-11-7-8-12-19(18)24)26-22(28)13-20(25-16(3)27)17-9-5-4-6-10-17/h4-12,15,20-21H,13-14H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | XFLPAIOVFOBOSS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |