C19H21ClN2O4S — CID 24575025
propan-2-yl 3-[(5-acetamidothiophene-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate (PubChem CID 24575025) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is propan-2-yl 3-[(5-acetamidothiophene-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(5-acetamidothiophene-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 24575025 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | propan-2-yl 3-[(5-acetamidothiophene-2-carbonyl)amino]-3-(2-chlorophenyl)propanoate |
| SMILES | CC(=O)Nc1ccc(C(=O)NC(CC(=O)OC(C)C)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-11(2)26-18(24)10-15(13-6-4-5-7-14(13)20)22-19(25)16-8-9-17(27-16)21-12(3)23/h4-9,11,15H,10H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | OLGYNOIKPJHPFU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |