C25H28N4O4 — CID 24516782
propan-2-yl 3-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 24516782) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 24516782 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(C(CC(=O)OC(C)C)NC(=O)/C=C/c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C25H28N4O4/c1-18(2)33-25(31)15-23(20-9-12-22(32-3)13-10-20)26-24(30)14-11-21-17-29(28-27-21)16-19-7-5-4-6-8-19/h4-14,17-18,23H,15-16H2,1-3H3,(H,26,30)/b14-11+ |
| InChIKey | HQEBXSHMCGOQKB-SDNWHVSQSA-N |
| XLogP | 3.55 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|