C16H20N4O2 — CID 18168449
(E)-3-(1-benzyltriazol-4-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide (PubChem CID 18168449) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18168449 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-(1-methoxypropan-2-yl)prop-2-enamide |
| SMILES | COCC(C)NC(=O)/C=C/c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C16H20N4O2/c1-13(12-22-2)17-16(21)9-8-15-11-20(19-18-15)10-14-6-4-3-5-7-14/h3-9,11,13H,10,12H2,1-2H3,(H,17,21)/b9-8+ |
| InChIKey | WAMAVLJEJBIZAJ-CMDGGOBGSA-N |
| XLogP | 1.49 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|