C24H20N4O2 — CID 26688818
(E)-3-(1-benzyltriazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 26688818) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26688818 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nn1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N4O2/c29-24(16-13-21-18-28(27-26-21)17-19-7-3-1-4-8-19)25-20-11-14-23(15-12-20)30-22-9-5-2-6-10-22/h1-16,18H,17H2,(H,25,29)/b16-13+ |
| InChIKey | BMRFREVWINYSBB-DTQAZKPQSA-N |
| XLogP | 4.77 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|