C19H18N4O3S — CID 9072642
(E)-3-(1-benzyltriazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide (PubChem CID 9072642) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9072642 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)/C=C/c2cn(Cc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C19H18N4O3S/c1-27(25,26)18-9-5-8-16(12-18)20-19(24)11-10-17-14-23(22-21-17)13-15-6-3-2-4-7-15/h2-12,14H,13H2,1H3,(H,20,24)/b11-10+ |
| InChIKey | VWWCXKBSWONFDV-ZHACJKMWSA-N |
| XLogP | 2.38 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|