C25H30N6O — CID 24525550
(E)-3-(1-benzyltriazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide (PubChem CID 24525550) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24525550 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)/C=C/c3cn(Cc4ccccc4)nn3)cc2C)CC1 |
| InChI | InChI=1S/C25H30N6O/c1-3-29-13-15-30(16-14-29)24-11-9-22(17-20(24)2)26-25(32)12-10-23-19-31(28-27-23)18-21-7-5-4-6-8-21/h4-12,17,19H,3,13-16,18H2,1-2H3,(H,26,32)/b12-10+ |
| InChIKey | VWKZZCLWDHZTFV-ZRDIBKRKSA-N |
| XLogP | 3.43 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|