C20H25N3OS — CID 27050693
(E)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 27050693) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is (E)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 27050693 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (E)-N-[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)/C=C/c3cccs3)cc2C)CC1 |
| InChI | InChI=1S/C20H25N3OS/c1-3-22-10-12-23(13-11-22)19-8-6-17(15-16(19)2)21-20(24)9-7-18-5-4-14-25-18/h4-9,14-15H,3,10-13H2,1-2H3,(H,21,24)/b9-7+ |
| InChIKey | KUOMDAYYTLDVHB-VQHVLOKHSA-N |
| XLogP | 3.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|