C18H17N2O3S- — CID 6929118
2-pyrrolidin-1-yl-5-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzoate (PubChem CID 6929118) has the molecular formula C18H17N2O3S- and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-5-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzoate.
| Compound Name | 2-pyrrolidin-1-yl-5-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 6929118 |
| Molecular Formula | C18H17N2O3S- |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-pyrrolidin-1-yl-5-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzoate |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccc(N2CCCC2)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C18H18N2O3S/c21-17(8-6-14-4-3-11-24-14)19-13-5-7-16(15(12-13)18(22)23)20-9-1-2-10-20/h3-8,11-12H,1-2,9-10H2,(H,19,21)(H,22,23)/p-1/b8-6+ |
| InChIKey | GSRKALOFKGAFPZ-SOFGYWHQSA-M |
| XLogP | 2.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|